C11H20N2O5 — CID 167262537
3-[2-(2-nitrosoethoxy)ethoxy]-N-(4-oxobutan-2-yl)propanamide (PubChem CID 167262537) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[2-(2-nitrosoethoxy)ethoxy]-N-(4-oxobutan-2-yl)propanamide.
| Compound Name | 3-[2-(2-nitrosoethoxy)ethoxy]-N-(4-oxobutan-2-yl)propanamide |
|---|---|
| PubChem CID | 167262537 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-[2-(2-nitrosoethoxy)ethoxy]-N-(4-oxobutan-2-yl)propanamide |
| SMILES | CC(CC=O)NC(=O)CCOCCOCCN=O |
| InChI | InChI=1S/C11H20N2O5/c1-10(2-5-14)13-11(15)3-6-17-8-9-18-7-4-12-16/h5,10H,2-4,6-9H2,1H3,(H,13,15) |
| InChIKey | FWKQRSAHYLRWKT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|