C34H40N4O5 — CID 167275508
(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide (PubChem CID 167275508) has the molecular formula C34H40N4O5 and a molecular weight of 584.72 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide |
|---|---|
| PubChem CID | 167275508 |
| Molecular Formula | C34H40N4O5 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide |
| SMILES | CCCC[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)Nc1ccc2c(c1)Oc1cc(N)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C34H40N4O5/c1-5-6-11-28(38-33(41)29(16-20(2)3)36-21(4)39)32(40)37-24-13-15-27-31(18-24)43-30-17-23(35)12-14-26(30)34(27)25-10-8-7-9-22(25)19-42-34/h7-10,12-15,17-18,20,28-29H,5-6,11,16,19,35H2,1-4H3,(H,36,39)(H,37,40)(H,38,41)/t28-,29-,34?/m0/s1 |
| InChIKey | DFACNQKMQXZEHH-DQEQZOJSSA-N |
| XLogP | 5.36 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|