C25H23N3O5 — CID 177291077
(2R)-2-amino-5-[(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)amino]-5-oxopentanoic acid (PubChem CID 177291077) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is (2R)-2-amino-5-[(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)amino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-amino-5-[(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 177291077 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (2R)-2-amino-5-[(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)amino]-5-oxopentanoic acid |
| SMILES | Nc1ccc2c(c1)Oc1cc(NC(=O)CC[C@@H](N)C(=O)O)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C25H23N3O5/c26-15-5-7-18-21(11-15)33-22-12-16(28-23(29)10-9-20(27)24(30)31)6-8-19(22)25(18)17-4-2-1-3-14(17)13-32-25/h1-8,11-12,20H,9-10,13,26-27H2,(H,28,29)(H,30,31)/t20-,25?/m1/s1 |
| InChIKey | PFWFFEYVRFHDBS-VGOKPJQXSA-N |
| XLogP | 3.33 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|