C26H28N4O3 — CID 177291086
(2S)-2,6-diamino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide (PubChem CID 177291086) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide |
|---|---|
| PubChem CID | 177291086 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (2S)-2,6-diamino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccc2c(c1)Oc1cc(N)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C26H28N4O3/c27-12-4-3-7-22(29)25(31)30-18-9-11-21-24(14-18)33-23-13-17(28)8-10-20(23)26(21)19-6-2-1-5-16(19)15-32-26/h1-2,5-6,8-11,13-14,22H,3-4,7,12,15,27-29H2,(H,30,31)/t22-,26?/m0/s1 |
| InChIKey | MSGKKOVAPVGGRR-CHQVSRGASA-N |
| XLogP | 3.59 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|