C34H41N5O5 — CID 167275946
(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-amino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide (PubChem CID 167275946) has the molecular formula C34H41N5O5 and a molecular weight of 599.73 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-amino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-amino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide |
|---|---|
| PubChem CID | 167275946 |
| Molecular Formula | C34H41N5O5 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-6-amino-N-(6'-aminospiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl)hexanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc2c(c1)Oc1cc(N)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C34H41N5O5/c1-20(2)16-29(37-21(3)40)33(42)39-28(10-6-7-15-35)32(41)38-24-12-14-27-31(18-24)44-30-17-23(36)11-13-26(30)34(27)25-9-5-4-8-22(25)19-43-34/h4-5,8-9,11-14,17-18,20,28-29H,6-7,10,15-16,19,35-36H2,1-3H3,(H,37,40)(H,38,41)(H,39,42)/t28-,29-,34?/m0/s1 |
| InChIKey | XDYNEFGDGPKSLM-DQEQZOJSSA-N |
| XLogP | 4.30 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|