C20H23N3O3S — CID 167279546
benzyl 2-[(5-methylsulfanyl-3-pyridinyl)methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 167279546) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is benzyl 2-[(5-methylsulfanyl-3-pyridinyl)methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(5-methylsulfanyl-3-pyridinyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167279546 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | benzyl 2-[(5-methylsulfanyl-3-pyridinyl)methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CSc1cncc(CNC(=O)C2CCCN2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-27-17-10-16(11-21-13-17)12-22-19(24)18-8-5-9-23(18)20(25)26-14-15-6-3-2-4-7-15/h2-4,6-7,10-11,13,18H,5,8-9,12,14H2,1H3,(H,22,24) |
| InChIKey | UPPSFFATIQCJHP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |