C21H41NO — CID 167287985
2,2,4,4,5-pentamethyl-N-(1,2,3-trimethyl-3-propan-2-ylcyclobutyl)hexanamide (PubChem CID 167287985) has the molecular formula C21H41NO and a molecular weight of 323.57 g/mol. Its IUPAC name is 2,2,4,4,5-pentamethyl-N-(1,2,3-trimethyl-3-propan-2-ylcyclobutyl)hexanamide.
| Compound Name | 2,2,4,4,5-pentamethyl-N-(1,2,3-trimethyl-3-propan-2-ylcyclobutyl)hexanamide |
|---|---|
| PubChem CID | 167287985 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | 2,2,4,4,5-pentamethyl-N-(1,2,3-trimethyl-3-propan-2-ylcyclobutyl)hexanamide |
| SMILES | CC(C)C(C)(C)CC(C)(C)C(=O)NC1(C)CC(C)(C(C)C)C1C |
| InChI | InChI=1S/C21H41NO/c1-14(2)18(6,7)12-19(8,9)17(23)22-21(11)13-20(10,15(3)4)16(21)5/h14-16H,12-13H2,1-11H3,(H,22,23) |
| InChIKey | JZQIYXLVUCPLIK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |