C31H36N4O4 — CID 167293609
1-[[(3E,5E)-7-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]-6-methylhepta-1,3,5-trien-3-yl]oxymethyl]cyclopropane-1-carbonitrile (PubChem CID 167293609) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 1-[[(3E,5E)-7-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]-6-methylhepta-1,3,5-trien-3-yl]oxymethyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[[(3E,5E)-7-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]-6-methylhepta-1,3,5-trien-3-yl]oxymethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 167293609 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 1-[[(3E,5E)-7-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]-6-methylhepta-1,3,5-trien-3-yl]oxymethyl]cyclopropane-1-carbonitrile |
| SMILES | C=C/C(=C\C=C(/C)CN1CCC(c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC1)OCC1(C#N)CC1 |
| InChI | InChI=1S/C31H36N4O4/c1-3-25(39-20-31(19-32)12-13-31)6-4-21(2)17-34-14-10-22(11-15-34)23-5-7-26-24(16-23)18-35(30(26)38)27-8-9-28(36)33-29(27)37/h3-7,16,22,27H,1,8-15,17-18,20H2,2H3,(H,33,36,37)/b21-4+,25-6+ |
| InChIKey | FDZRWJKPVQXKJM-WKQVJPBJSA-N |
| XLogP | 3.96 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|