C22H29N3O3 — CID 167300392
2-[5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(methylamino)phenoxy]propanal (PubChem CID 167300392) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(methylamino)phenoxy]propanal.
| Compound Name | 2-[5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(methylamino)phenoxy]propanal |
|---|---|
| PubChem CID | 167300392 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-[5-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-(methylamino)phenoxy]propanal |
| SMILES | CNc1ccc(Nc2ccc(N3CC(C)OC(C)C3)cc2)cc1OC(C)C=O |
| InChI | InChI=1S/C22H29N3O3/c1-15-12-25(13-16(2)27-15)20-8-5-18(6-9-20)24-19-7-10-21(23-4)22(11-19)28-17(3)14-26/h5-11,14-17,23-24H,12-13H2,1-4H3 |
| InChIKey | DMSHZRGXFJIXPK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|