C19H23N3O3S2 — CID 167303957
N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-6,7-dihydro-5H-pyrano[3,2-c][1,2]thiazole-3-sulfonamide (PubChem CID 167303957) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-6,7-dihydro-5H-pyrano[3,2-c][1,2]thiazole-3-sulfonamide.
| Compound Name | N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-6,7-dihydro-5H-pyrano[3,2-c][1,2]thiazole-3-sulfonamide |
|---|---|
| PubChem CID | 167303957 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-6,7-dihydro-5H-pyrano[3,2-c][1,2]thiazole-3-sulfonamide |
| SMILES | O=S(=O)(NCNc1c2c(cc3c1CCC3)CCC2)c1snc2c1OCCC2 |
| InChI | InChI=1S/C19H23N3O3S2/c23-27(24,19-18-16(22-26-19)8-3-9-25-18)21-11-20-17-14-6-1-4-12(14)10-13-5-2-7-15(13)17/h10,20-21H,1-9,11H2 |
| InChIKey | BXMDJZUDVLNENP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|