C23H35N3O2S — CID 155120721
(1S,5R)-9-ethyl-N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-9-azabicyclo[3.3.1]nonane-3-sulfonamide (PubChem CID 155120721) has the molecular formula C23H35N3O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is (1S,5R)-9-ethyl-N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-9-azabicyclo[3.3.1]nonane-3-sulfonamide.
| Compound Name | (1S,5R)-9-ethyl-N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-9-azabicyclo[3.3.1]nonane-3-sulfonamide |
|---|---|
| PubChem CID | 155120721 |
| Molecular Formula | C23H35N3O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (1S,5R)-9-ethyl-N-[(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methyl]-9-azabicyclo[3.3.1]nonane-3-sulfonamide |
| SMILES | CCN1[C@@H]2CCC[C@H]1CC(S(=O)(=O)NCNc1c3c(cc4c1CCC4)CCC3)C2 |
| InChI | InChI=1S/C23H35N3O2S/c1-2-26-18-8-5-9-19(26)14-20(13-18)29(27,28)25-15-24-23-21-10-3-6-16(21)12-17-7-4-11-22(17)23/h12,18-20,24-25H,2-11,13-15H2,1H3/t18-,19+,20? |
| InChIKey | NBFCKDKXKRNWKF-YOFSQIOKSA-N |
| XLogP | 3.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|