C17H17FN2O6 — CID 167311571
(2,5-dioxopyrrolidin-1-yl) 3-(4-fluorophenyl)-3-(prop-2-enoxycarbonylamino)propanoate (PubChem CID 167311571) has the molecular formula C17H17FN2O6 and a molecular weight of 364.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(4-fluorophenyl)-3-(prop-2-enoxycarbonylamino)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-fluorophenyl)-3-(prop-2-enoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 167311571 |
| Molecular Formula | C17H17FN2O6 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-fluorophenyl)-3-(prop-2-enoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)NC(CC(=O)ON1C(=O)CCC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O6/c1-2-9-25-17(24)19-13(11-3-5-12(18)6-4-11)10-16(23)26-20-14(21)7-8-15(20)22/h2-6,13H,1,7-10H2,(H,19,24) |
| InChIKey | BEYHNQXSATYPBB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|