C31H30NO+ — CID 167317351
1-methyl-2-(2,2,7,12,12-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium (PubChem CID 167317351) has the molecular formula C31H30NO+ and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-methyl-2-(2,2,7,12,12-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(2,2,7,12,12-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167317351 |
| Molecular Formula | C31H30NO+ |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-methyl-2-(2,2,7,12,12-pentamethyl-10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c3c(oc2c1-c1cccc[n+]1C)C(C)(C)c1c(ccc2ccccc12)C3(C)C |
| InChI | InChI=1S/C31H30NO/c1-19-14-16-22-27-29(33-28(22)25(19)24-13-9-10-18-32(24)6)31(4,5)26-21-12-8-7-11-20(21)15-17-23(26)30(27,2)3/h7-18H,1-6H3/q+1 |
| InChIKey | WWZCRFUKGCVZEB-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|