C28H35N5O8S — CID 167320183
2-[(2R)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]sulfanylacetic acid (PubChem CID 167320183) has the molecular formula C28H35N5O8S and a molecular weight of 601.68 g/mol. Its IUPAC name is 2-[(2R)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]sulfanylacetic acid.
| Compound Name | 2-[(2R)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 167320183 |
| Molecular Formula | C28H35N5O8S |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 2-[(2R)-3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]sulfanylacetic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)[C@H](CSCC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H35N5O8S/c29-33-31-10-12-39-14-16-40-15-13-38-11-9-30-27(36)25(18-42-19-26(34)35)32-28(37)41-17-24-22-7-3-1-5-20(22)21-6-2-4-8-23(21)24/h1-8,24-25H,9-19H2,(H,30,36)(H,32,37)(H,34,35)/t25-/m0/s1 |
| InChIKey | HHLLMEOAIUUABH-VWLOTQADSA-N |
| XLogP | 3.19 |
| TPSA | 181.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|