C22H37IO5Si — CID 167320424
(4R,7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-ene-2,8-dione (PubChem CID 167320424) has the molecular formula C22H37IO5Si and a molecular weight of 536.52 g/mol. Its IUPAC name is (4R,7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-ene-2,8-dione.
| Compound Name | (4R,7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 167320424 |
| Molecular Formula | C22H37IO5Si |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | (4R,7R,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-ene-2,8-dione |
| SMILES | C/C(=C\I)[C@H]1OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@](C)(O)C(=O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C22H37IO5Si/c1-15-9-10-18(24)22(6,26)12-11-17(28-29(7,8)21(3,4)5)13-19(25)27-20(15)16(2)14-23/h9-10,14-15,17,20,26H,11-13H2,1-8H3/b10-9+,16-14+/t15-,17+,20-,22+/m0/s1 |
| InChIKey | MNPWFYFPWQUXBV-KNPIDCAKSA-N |
| XLogP | 5.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|