C20H21FN2O4S — CID 167328193
[1-(2,4-dimethylphenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol (PubChem CID 167328193) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is [1-(2,4-dimethylphenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol.
| Compound Name | [1-(2,4-dimethylphenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 167328193 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [1-(2,4-dimethylphenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol |
| SMILES | [C-]#[N+]c1ccc(OCC2(CO)CN(S(=O)(=O)c3ccc(C)cc3C)C2)cc1F |
| InChI | InChI=1S/C20H21FN2O4S/c1-14-4-7-19(15(2)8-14)28(25,26)23-10-20(11-23,12-24)13-27-16-5-6-18(22-3)17(21)9-16/h4-9,24H,10-13H2,1-2H3 |
| InChIKey | NLMZZJFRMOHMJK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|