C19H19Cl2FN4O5S2 — CID 167328219
2-amino-N-[1-(2,4-dichlorophenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]ethanesulfonamide (PubChem CID 167328219) has the molecular formula C19H19Cl2FN4O5S2 and a molecular weight of 537.42 g/mol. Its IUPAC name is 2-amino-N-[1-(2,4-dichlorophenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]ethanesulfonamide.
| Compound Name | 2-amino-N-[1-(2,4-dichlorophenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 167328219 |
| Molecular Formula | C19H19Cl2FN4O5S2 |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-amino-N-[1-(2,4-dichlorophenyl)sulfonyl-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]ethanesulfonamide |
| SMILES | [C-]#[N+]c1ccc(OCC2(NS(=O)(=O)CCN)CN(S(=O)(=O)c3ccc(Cl)cc3Cl)C2)cc1F |
| InChI | InChI=1S/C19H19Cl2FN4O5S2/c1-24-17-4-3-14(9-16(17)22)31-12-19(25-32(27,28)7-6-23)10-26(11-19)33(29,30)18-5-2-13(20)8-15(18)21/h2-5,8-9,25H,6-7,10-12,23H2 |
| InChIKey | KPIRXLCFXZVIMG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|