C20H18ClFN2O6S — CID 167328186
methyl 3-chloro-4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonylbenzoate (PubChem CID 167328186) has the molecular formula C20H18ClFN2O6S and a molecular weight of 468.89 g/mol. Its IUPAC name is methyl 3-chloro-4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 3-chloro-4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 167328186 |
| Molecular Formula | C20H18ClFN2O6S |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | methyl 3-chloro-4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonylbenzoate |
| SMILES | [C-]#[N+]c1ccc(OCC2(CO)CN(S(=O)(=O)c3ccc(C(=O)OC)cc3Cl)C2)cc1F |
| InChI | InChI=1S/C20H18ClFN2O6S/c1-23-17-5-4-14(8-16(17)22)30-12-20(11-25)9-24(10-20)31(27,28)18-6-3-13(7-15(18)21)19(26)29-2/h3-8,25H,9-12H2,2H3 |
| InChIKey | HUEBNMKSWYCFIJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|