C20H18FN3O4S — CID 167328182
4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonyl-3-methylbenzonitrile (PubChem CID 167328182) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonyl-3-methylbenzonitrile.
| Compound Name | 4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonyl-3-methylbenzonitrile |
|---|---|
| PubChem CID | 167328182 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-[3-[(3-fluoro-4-isocyanophenoxy)methyl]-3-(hydroxymethyl)azetidin-1-yl]sulfonyl-3-methylbenzonitrile |
| SMILES | [C-]#[N+]c1ccc(OCC2(CO)CN(S(=O)(=O)c3ccc(C#N)cc3C)C2)cc1F |
| InChI | InChI=1S/C20H18FN3O4S/c1-14-7-15(9-22)3-6-19(14)29(26,27)24-10-20(11-24,12-25)13-28-16-4-5-18(23-2)17(21)8-16/h3-8,25H,10-13H2,1H3 |
| InChIKey | VWLMVJXNIZZNAV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|