C18H17FN2O4S — CID 167328206
[1-(benzenesulfonyl)-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol (PubChem CID 167328206) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol.
| Compound Name | [1-(benzenesulfonyl)-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 167328206 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [1-(benzenesulfonyl)-3-[(3-fluoro-4-isocyanophenoxy)methyl]azetidin-3-yl]methanol |
| SMILES | [C-]#[N+]c1ccc(OCC2(CO)CN(S(=O)(=O)c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C18H17FN2O4S/c1-20-17-8-7-14(9-16(17)19)25-13-18(12-22)10-21(11-18)26(23,24)15-5-3-2-4-6-15/h2-9,22H,10-13H2 |
| InChIKey | ZVSBZLVXGBCNMZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|