C15H12NO4- — CID 167333205
3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate (PubChem CID 167333205) has the molecular formula C15H12NO4- and a molecular weight of 270.26 g/mol. Its IUPAC name is 3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate.
| Compound Name | 3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 167333205 |
| Molecular Formula | C15H12NO4- |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)benzoate |
| SMILES | O=C([O-])c1cccc(N2C(=O)C3=C(CCCC3)C2=O)c1 |
| InChI | InChI=1S/C15H13NO4/c17-13-11-6-1-2-7-12(11)14(18)16(13)10-5-3-4-9(8-10)15(19)20/h3-5,8H,1-2,6-7H2,(H,19,20)/p-1 |
| InChIKey | LRGMSYGCAQIQCT-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|