C22H24FNO4S — CID 167337641
tert-butyl 3-[4-fluoro-5-(4-methoxy-4-oxobutyl)thiophen-3-yl]indole-1-carboxylate (PubChem CID 167337641) has the molecular formula C22H24FNO4S and a molecular weight of 417.50 g/mol. Its IUPAC name is tert-butyl 3-[4-fluoro-5-(4-methoxy-4-oxobutyl)thiophen-3-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[4-fluoro-5-(4-methoxy-4-oxobutyl)thiophen-3-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 167337641 |
| Molecular Formula | C22H24FNO4S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | tert-butyl 3-[4-fluoro-5-(4-methoxy-4-oxobutyl)thiophen-3-yl]indole-1-carboxylate |
| SMILES | COC(=O)CCCc1scc(-c2cn(C(=O)OC(C)(C)C)c3ccccc23)c1F |
| InChI | InChI=1S/C22H24FNO4S/c1-22(2,3)28-21(26)24-12-15(14-8-5-6-9-17(14)24)16-13-29-18(20(16)23)10-7-11-19(25)27-4/h5-6,8-9,12-13H,7,10-11H2,1-4H3 |
| InChIKey | JGHXPEORSNQBHK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |