C9H11O4Si — CID 167346601
CID 167346601 (PubChem CID 167346601) has the molecular formula C9H11O4Si and a molecular weight of 211.27 g/mol.
| Compound Name | CID 167346601 |
|---|---|
| PubChem CID | 167346601 |
| Molecular Formula | C9H11O4Si |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | — |
| SMILES | O=C1OCC2C3OC(CC3OC[Si])C12 |
| InChI | InChI=1S/C9H11O4Si/c10-9-7-4(2-11-9)8-6(12-3-14)1-5(7)13-8/h4-8H,1-3H2 |
| InChIKey | XRNNVCJNCXQYDT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|