C22H40N4O2 — CID 167348686
N-[4-(dimethylamino)-1-(3-methylpiperidin-2-yl)-4-oxobutyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348686) has the molecular formula C22H40N4O2 and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[4-(dimethylamino)-1-(3-methylpiperidin-2-yl)-4-oxobutyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)-1-(3-methylpiperidin-2-yl)-4-oxobutyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348686 |
| Molecular Formula | C22H40N4O2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | N-[4-(dimethylamino)-1-(3-methylpiperidin-2-yl)-4-oxobutyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCCC2CC(C(=O)NC(CCC(=O)N(C)C)C3NCCCC3C)NC12 |
| InChI | InChI=1S/C22H40N4O2/c1-14-7-5-9-16-13-18(24-20(14)16)22(28)25-17(10-11-19(27)26(3)4)21-15(2)8-6-12-23-21/h14-18,20-21,23-24H,5-13H2,1-4H3,(H,25,28) |
| InChIKey | PYCNMSXGTDJPJM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |