C18H31ClN2O — CID 146759780
N-[(1S)-1-(2-chlorocyclohexyl)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 146759780) has the molecular formula C18H31ClN2O and a molecular weight of 326.91 g/mol. Its IUPAC name is N-[(1S)-1-(2-chlorocyclohexyl)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1S)-1-(2-chlorocyclohexyl)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146759780 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-[(1S)-1-(2-chlorocyclohexyl)ethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCCC2CC(C(=O)N[C@@H](C)C3CCCCC3Cl)NC12 |
| InChI | InChI=1S/C18H31ClN2O/c1-11-6-5-7-13-10-16(21-17(11)13)18(22)20-12(2)14-8-3-4-9-15(14)19/h11-17,21H,3-10H2,1-2H3,(H,20,22)/t11?,12-,13?,14?,15?,16?,17?/m0/s1 |
| InChIKey | FJACUNBUJJDQKL-ZICFAKEHSA-N |
| XLogP | 3.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|