C24H41N5O2 — CID 167348826
N-[[5-(azetidin-3-ylcarbamoyl)-3-methylpiperidin-2-yl]-cyclopropylmethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348826) has the molecular formula C24H41N5O2 and a molecular weight of 431.63 g/mol. Its IUPAC name is N-[[5-(azetidin-3-ylcarbamoyl)-3-methylpiperidin-2-yl]-cyclopropylmethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[[5-(azetidin-3-ylcarbamoyl)-3-methylpiperidin-2-yl]-cyclopropylmethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348826 |
| Molecular Formula | C24H41N5O2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | N-[[5-(azetidin-3-ylcarbamoyl)-3-methylpiperidin-2-yl]-cyclopropylmethyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCCC2CC(C(=O)NC(C3CC3)C3NCC(C(=O)NC4CNC4)CC3C)NC12 |
| InChI | InChI=1S/C24H41N5O2/c1-13-4-3-5-16-9-19(28-20(13)16)24(31)29-22(15-6-7-15)21-14(2)8-17(10-26-21)23(30)27-18-11-25-12-18/h13-22,25-26,28H,3-12H2,1-2H3,(H,27,30)(H,29,31) |
| InChIKey | CSERNPOFCYBSKH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |