C16H30N4O — CID 147438079
7-methyl-N-[1-(1-methylpyrazolidin-3-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 147438079) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is 7-methyl-N-[1-(1-methylpyrazolidin-3-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 7-methyl-N-[1-(1-methylpyrazolidin-3-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 147438079 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 7-methyl-N-[1-(1-methylpyrazolidin-3-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCCC2CC(C(=O)NC(C)C3CCN(C)N3)NC12 |
| InChI | InChI=1S/C16H30N4O/c1-10-5-4-6-12-9-14(18-15(10)12)16(21)17-11(2)13-7-8-20(3)19-13/h10-15,18-19H,4-9H2,1-3H3,(H,17,21) |
| InChIKey | CRTHVEGDLDADRJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |