C24H38FN3O2 — CID 167380412
4-fluoro-7-methyl-N-[3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380412) has the molecular formula C24H38FN3O2 and a molecular weight of 419.59 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380412 |
| Molecular Formula | C24H38FN3O2 |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 4-fluoro-7-methyl-N-[3-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4CCN5C(=O)CCC5C4)C3)NC12 |
| InChI | InChI=1S/C24H38FN3O2/c1-14-5-7-20(25)19-13-21(27-23(14)19)24(30)26-17-4-2-3-15(11-17)16-9-10-28-18(12-16)6-8-22(28)29/h14-21,23,27H,2-13H2,1H3,(H,26,30) |
| InChIKey | WIVVYDPZMIUBCF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |