C21H36FN3O — CID 152933667
4-fluoro-7-methyl-N-[(1S,3S)-3-piperidin-4-ylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 152933667) has the molecular formula C21H36FN3O and a molecular weight of 365.54 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[(1S,3S)-3-piperidin-4-ylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[(1S,3S)-3-piperidin-4-ylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 152933667 |
| Molecular Formula | C21H36FN3O |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | 4-fluoro-7-methyl-N-[(1S,3S)-3-piperidin-4-ylcyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)N[C@H]3CCC[C@H](C4CCNCC4)C3)NC12 |
| InChI | InChI=1S/C21H36FN3O/c1-13-5-6-18(22)17-12-19(25-20(13)17)21(26)24-16-4-2-3-15(11-16)14-7-9-23-10-8-14/h13-20,23,25H,2-12H2,1H3,(H,24,26)/t13?,15-,16-,17?,18?,19?,20?/m0/s1 |
| InChIKey | WHAWPUWSXZRRNL-QPQVBTQVSA-N |
| XLogP | 2.78 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |