C19H33FN4O2S — CID 167380415
4-fluoro-N-[3-[5-(hydroxymethyl)-1,3,4-thiadiazolidin-2-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380415) has the molecular formula C19H33FN4O2S and a molecular weight of 400.56 g/mol. Its IUPAC name is 4-fluoro-N-[3-[5-(hydroxymethyl)-1,3,4-thiadiazolidin-2-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[3-[5-(hydroxymethyl)-1,3,4-thiadiazolidin-2-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380415 |
| Molecular Formula | C19H33FN4O2S |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 4-fluoro-N-[3-[5-(hydroxymethyl)-1,3,4-thiadiazolidin-2-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4NNC(CO)S4)C3)NC12 |
| InChI | InChI=1S/C19H33FN4O2S/c1-10-5-6-14(20)13-8-15(22-17(10)13)18(26)21-12-4-2-3-11(7-12)19-24-23-16(9-25)27-19/h10-17,19,22-25H,2-9H2,1H3,(H,21,26) |
| InChIKey | MTZHWRKJRWYPMM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |