C22H36F2N4O2 — CID 167380577
4-fluoro-N-[3-[4-(2-fluoroacetyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380577) has the molecular formula C22H36F2N4O2 and a molecular weight of 426.55 g/mol. Its IUPAC name is 4-fluoro-N-[3-[4-(2-fluoroacetyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[3-[4-(2-fluoroacetyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380577 |
| Molecular Formula | C22H36F2N4O2 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 4-fluoro-N-[3-[4-(2-fluoroacetyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(N4CCN(C(=O)CF)CC4)C3)NC12 |
| InChI | InChI=1S/C22H36F2N4O2/c1-14-5-6-18(24)17-12-19(26-21(14)17)22(30)25-15-3-2-4-16(11-15)27-7-9-28(10-8-27)20(29)13-23/h14-19,21,26H,2-13H2,1H3,(H,25,30) |
| InChIKey | QYZCJSWYZWJJFI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |