C23H40FN5O2 — CID 167380472
4-fluoro-N-[(1R,3R)-3-[4-formyl-3-(methylaminomethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380472) has the molecular formula C23H40FN5O2 and a molecular weight of 437.60 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,3R)-3-[4-formyl-3-(methylaminomethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[(1R,3R)-3-[4-formyl-3-(methylaminomethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380472 |
| Molecular Formula | C23H40FN5O2 |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.32 |
| IUPAC Name | 4-fluoro-N-[(1R,3R)-3-[4-formyl-3-(methylaminomethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CNCC1CN([C@@H]2CCC[C@@H](NC(=O)C3CC4C(F)CCC(C)C4N3)C2)CCN1C=O |
| InChI | InChI=1S/C23H40FN5O2/c1-15-6-7-20(24)19-11-21(27-22(15)19)23(31)26-16-4-3-5-17(10-16)28-8-9-29(14-30)18(13-28)12-25-2/h14-22,25,27H,3-13H2,1-2H3,(H,26,31)/t15?,16-,17-,18?,19?,20?,21?,22?/m1/s1 |
| InChIKey | HUSYARMDHFXYAI-WWAKOARVSA-N |
| XLogP | 0.89 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|