C23H39FN4O3 — CID 167348697
4-fluoro-N-[(1R,3S)-3-[3-[(2-hydroxyacetyl)-methylamino]pyrrolidin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348697) has the molecular formula C23H39FN4O3 and a molecular weight of 438.59 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,3S)-3-[3-[(2-hydroxyacetyl)-methylamino]pyrrolidin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[(1R,3S)-3-[3-[(2-hydroxyacetyl)-methylamino]pyrrolidin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348697 |
| Molecular Formula | C23H39FN4O3 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 4-fluoro-N-[(1R,3S)-3-[3-[(2-hydroxyacetyl)-methylamino]pyrrolidin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)N[C@@H]3CCC[C@H](N4CCC(N(C)C(=O)CO)C4)C3)NC12 |
| InChI | InChI=1S/C23H39FN4O3/c1-14-6-7-19(24)18-11-20(26-22(14)18)23(31)25-15-4-3-5-16(10-15)28-9-8-17(12-28)27(2)21(30)13-29/h14-20,22,26,29H,3-13H2,1-2H3,(H,25,31)/t14?,15-,16+,17?,18?,19?,20?,22?/m1/s1 |
| InChIKey | RKKUQNFKSWYNDD-AJCHPDAUSA-N |
| XLogP | 1.05 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |