C22H38FN3O2 — CID 146955310
4-fluoro-N-[3-(4-methoxypiperidin-1-yl)cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 146955310) has the molecular formula C22H38FN3O2 and a molecular weight of 395.56 g/mol. Its IUPAC name is 4-fluoro-N-[3-(4-methoxypiperidin-1-yl)cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[3-(4-methoxypiperidin-1-yl)cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146955310 |
| Molecular Formula | C22H38FN3O2 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 4-fluoro-N-[3-(4-methoxypiperidin-1-yl)cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | COC1CCN(C2CCCC(NC(=O)C3CC4C(F)CCC(C)C4N3)C2)CC1 |
| InChI | InChI=1S/C22H38FN3O2/c1-14-6-7-19(23)18-13-20(25-21(14)18)22(27)24-15-4-3-5-16(12-15)26-10-8-17(28-2)9-11-26/h14-21,25H,3-13H2,1-2H3,(H,24,27) |
| InChIKey | RONIFNNFYPFSIX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |