C24H43FN4O2 — CID 147238814
N-[3-[4-[(dimethylamino)methyl]-4-hydroxypiperidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 147238814) has the molecular formula C24H43FN4O2 and a molecular weight of 438.63 g/mol. Its IUPAC name is N-[3-[4-[(dimethylamino)methyl]-4-hydroxypiperidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-[4-[(dimethylamino)methyl]-4-hydroxypiperidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 147238814 |
| Molecular Formula | C24H43FN4O2 |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | N-[3-[4-[(dimethylamino)methyl]-4-hydroxypiperidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(N4CCC(O)(CN(C)C)CC4)C3)NC12 |
| InChI | InChI=1S/C24H43FN4O2/c1-16-7-8-20(25)19-14-21(27-22(16)19)23(30)26-17-5-4-6-18(13-17)29-11-9-24(31,10-12-29)15-28(2)3/h16-22,27,31H,4-15H2,1-3H3,(H,26,30) |
| InChIKey | FBYHDANQJHYNJY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |