C22H37FN4O2 — CID 167348495
4-fluoro-7-methyl-N-[(1S,3S)-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348495) has the molecular formula C22H37FN4O2 and a molecular weight of 408.56 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[(1S,3S)-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[(1S,3S)-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348495 |
| Molecular Formula | C22H37FN4O2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 4-fluoro-7-methyl-N-[(1S,3S)-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)N[C@H]3CCC[C@H](N4CCCN(C)C(=O)C4)C3)NC12 |
| InChI | InChI=1S/C22H37FN4O2/c1-14-7-8-18(23)17-12-19(25-21(14)17)22(29)24-15-5-3-6-16(11-15)27-10-4-9-26(2)20(28)13-27/h14-19,21,25H,3-13H2,1-2H3,(H,24,29)/t14?,15-,16-,17?,18?,19?,21?/m0/s1 |
| InChIKey | INJIHUXTHMUOTR-KOLBDPLOSA-N |
| XLogP | 1.69 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |