C23H36FN5O2 — CID 167380513
4-fluoro-7-methyl-N-[(1R,3R)-3-(2-methyl-3-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380513) has the molecular formula C23H36FN5O2 and a molecular weight of 433.57 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[(1R,3R)-3-(2-methyl-3-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[(1R,3R)-3-(2-methyl-3-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380513 |
| Molecular Formula | C23H36FN5O2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 4-fluoro-7-methyl-N-[(1R,3R)-3-(2-methyl-3-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)N[C@@H]3CCC[C@@H](N4CCn5c(cn(C)c5=O)C4)C3)NC12 |
| InChI | InChI=1S/C23H36FN5O2/c1-14-6-7-19(24)18-11-20(26-21(14)18)22(30)25-15-4-3-5-16(10-15)28-8-9-29-17(13-28)12-27(2)23(29)31/h12,14-16,18-21,26H,3-11,13H2,1-2H3,(H,25,30)/t14?,15-,16-,18?,19?,20?,21?/m1/s1 |
| InChIKey | ROFWHLLVPYYMNR-IDBRHNCUSA-N |
| XLogP | 1.54 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |