C23H36F4N4O2 — CID 167348453
N-[(1R,3R)-3-[(3R)-4-acetyl-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348453) has the molecular formula C23H36F4N4O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[(1R,3R)-3-[(3R)-4-acetyl-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3R)-3-[(3R)-4-acetyl-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348453 |
| Molecular Formula | C23H36F4N4O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | N-[(1R,3R)-3-[(3R)-4-acetyl-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CCN([C@@H]2CCC[C@@H](NC(=O)C3CC4C(F)CCC(C)C4N3)C2)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C23H36F4N4O2/c1-13-6-7-18(24)17-11-19(29-21(13)17)22(33)28-15-4-3-5-16(10-15)30-8-9-31(14(2)32)20(12-30)23(25,26)27/h13,15-21,29H,3-12H2,1-2H3,(H,28,33)/t13?,15-,16-,17?,18?,19?,20-,21?/m1/s1 |
| InChIKey | YYUPMQUTFVABSW-QQUGISJMSA-N |
| XLogP | 2.62 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |