C23H39FN4O2 — CID 167348800
N-[(1R,3S)-3-[(2S)-4-acetyl-2-methylpiperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348800) has the molecular formula C23H39FN4O2 and a molecular weight of 422.59 g/mol. Its IUPAC name is N-[(1R,3S)-3-[(2S)-4-acetyl-2-methylpiperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3S)-3-[(2S)-4-acetyl-2-methylpiperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348800 |
| Molecular Formula | C23H39FN4O2 |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | N-[(1R,3S)-3-[(2S)-4-acetyl-2-methylpiperazin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CCN([C@H]2CCC[C@@H](NC(=O)C3CC4C(F)CCC(C)C4N3)C2)[C@@H](C)C1 |
| InChI | InChI=1S/C23H39FN4O2/c1-14-7-8-20(24)19-12-21(26-22(14)19)23(30)25-17-5-4-6-18(11-17)28-10-9-27(16(3)29)13-15(28)2/h14-15,17-22,26H,4-13H2,1-3H3,(H,25,30)/t14?,15-,17+,18-,19?,20?,21?,22?/m0/s1 |
| InChIKey | RLQOLMGQJNTTDS-JTLXVSRISA-N |
| XLogP | 2.08 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |