C23H38FN3O2 — CID 152796291
N-[3-(3-cyclopropylmorpholin-4-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 152796291) has the molecular formula C23H38FN3O2 and a molecular weight of 407.57 g/mol. Its IUPAC name is N-[3-(3-cyclopropylmorpholin-4-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(3-cyclopropylmorpholin-4-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 152796291 |
| Molecular Formula | C23H38FN3O2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-[3-(3-cyclopropylmorpholin-4-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(N4CCOCC4C4CC4)C3)NC12 |
| InChI | InChI=1S/C23H38FN3O2/c1-14-5-8-19(24)18-12-20(26-22(14)18)23(28)25-16-3-2-4-17(11-16)27-9-10-29-13-21(27)15-6-7-15/h14-22,26H,2-13H2,1H3,(H,25,28) |
| InChIKey | RBXVEQMOYDWSGE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |