C18H31FN4O2 — CID 167380578
4-fluoro-7-methyl-N-[3-(1,3,4-oxadiazolidin-2-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380578) has the molecular formula C18H31FN4O2 and a molecular weight of 354.47 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[3-(1,3,4-oxadiazolidin-2-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[3-(1,3,4-oxadiazolidin-2-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380578 |
| Molecular Formula | C18H31FN4O2 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-fluoro-7-methyl-N-[3-(1,3,4-oxadiazolidin-2-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4NNCO4)C3)NC12 |
| InChI | InChI=1S/C18H31FN4O2/c1-10-5-6-14(19)13-8-15(22-16(10)13)17(24)21-12-4-2-3-11(7-12)18-23-20-9-25-18/h10-16,18,20,22-23H,2-9H2,1H3,(H,21,24) |
| InChIKey | AGMTVCBIFYXNRG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |