C21H38FN5O2 — CID 167348541
N-[(1R,3S)-3-[5-[(dimethylamino)methyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348541) has the molecular formula C21H38FN5O2 and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[(1R,3S)-3-[5-[(dimethylamino)methyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3S)-3-[5-[(dimethylamino)methyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348541 |
| Molecular Formula | C21H38FN5O2 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | N-[(1R,3S)-3-[5-[(dimethylamino)methyl]-1,3,4-oxadiazolidin-2-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)N[C@@H]3CCC[C@H](C4NNC(CN(C)C)O4)C3)NC12 |
| InChI | InChI=1S/C21H38FN5O2/c1-12-7-8-16(22)15-10-17(24-19(12)15)20(28)23-14-6-4-5-13(9-14)21-26-25-18(29-21)11-27(2)3/h12-19,21,24-26H,4-11H2,1-3H3,(H,23,28)/t12?,13-,14+,15?,16?,17?,18?,19?,21?/m0/s1 |
| InChIKey | LCKKEBMGVWSUGA-AEOADFRFSA-N |
| XLogP | 1.11 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |