C18H32FN5O2 — CID 147862736
N-[3-(5-amino-1,3,4-oxadiazolidin-2-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 147862736) has the molecular formula C18H32FN5O2 and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-oxadiazolidin-2-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(5-amino-1,3,4-oxadiazolidin-2-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 147862736 |
| Molecular Formula | C18H32FN5O2 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-[3-(5-amino-1,3,4-oxadiazolidin-2-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4NNC(N)O4)C3)NC12 |
| InChI | InChI=1S/C18H32FN5O2/c1-9-5-6-13(19)12-8-14(22-15(9)12)16(25)21-11-4-2-3-10(7-11)17-23-24-18(20)26-17/h9-15,17-18,22-24H,2-8,20H2,1H3,(H,21,25) |
| InChIKey | XYNRTLWZBDHWMT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |