C18H33FN6O — CID 147183732
N-[3-(5-amino-1,2,4-triazolidin-3-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 147183732) has the molecular formula C18H33FN6O and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[3-(5-amino-1,2,4-triazolidin-3-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(5-amino-1,2,4-triazolidin-3-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 147183732 |
| Molecular Formula | C18H33FN6O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | N-[3-(5-amino-1,2,4-triazolidin-3-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4NNC(N)N4)C3)NC12 |
| InChI | InChI=1S/C18H33FN6O/c1-9-5-6-13(19)12-8-14(22-15(9)12)17(26)21-11-4-2-3-10(7-11)16-23-18(20)25-24-16/h9-16,18,22-25H,2-8,20H2,1H3,(H,21,26) |
| InChIKey | OBHWBYOFLXGVDK-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |