C25H42FN3O — CID 167348507
4-fluoro-7-methyl-N-[3-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-5-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348507) has the molecular formula C25H42FN3O and a molecular weight of 419.63 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[3-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-5-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[3-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-5-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348507 |
| Molecular Formula | C25H42FN3O |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.33 |
| IUPAC Name | 4-fluoro-7-methyl-N-[3-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-5-yl)cyclohexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4CCC5C(CCN5C)C4)C3)NC12 |
| InChI | InChI=1S/C25H42FN3O/c1-15-6-8-21(26)20-14-22(28-24(15)20)25(30)27-19-5-3-4-16(13-19)17-7-9-23-18(12-17)10-11-29(23)2/h15-24,28H,3-14H2,1-2H3,(H,27,30) |
| InChIKey | PWEWMAAMWVJFAV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |