C26H45FN4O — CID 167380448
4-fluoro-N-[3-[4-(imidazolidin-1-ylmethyl)cyclohexyl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380448) has the molecular formula C26H45FN4O and a molecular weight of 448.67 g/mol. Its IUPAC name is 4-fluoro-N-[3-[4-(imidazolidin-1-ylmethyl)cyclohexyl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[3-[4-(imidazolidin-1-ylmethyl)cyclohexyl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380448 |
| Molecular Formula | C26H45FN4O |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 4-fluoro-N-[3-[4-(imidazolidin-1-ylmethyl)cyclohexyl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CCCC(C4CCC(CN5CCNC5)CC4)C3)NC12 |
| InChI | InChI=1S/C26H45FN4O/c1-17-5-10-23(27)22-14-24(30-25(17)22)26(32)29-21-4-2-3-20(13-21)19-8-6-18(7-9-19)15-31-12-11-28-16-31/h17-25,28,30H,2-16H2,1H3,(H,29,32) |
| InChIKey | OUBFMATTXJLZGZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |