C23H37FN4O2 — CID 167348662
N-[(1R,3R)-3-(2-acetyl-2,6-diazaspiro[3.3]heptan-6-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348662) has the molecular formula C23H37FN4O2 and a molecular weight of 420.57 g/mol. Its IUPAC name is N-[(1R,3R)-3-(2-acetyl-2,6-diazaspiro[3.3]heptan-6-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3R)-3-(2-acetyl-2,6-diazaspiro[3.3]heptan-6-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348662 |
| Molecular Formula | C23H37FN4O2 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | N-[(1R,3R)-3-(2-acetyl-2,6-diazaspiro[3.3]heptan-6-yl)cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CC2(C1)CN([C@@H]1CCC[C@@H](NC(=O)C3CC4C(F)CCC(C)C4N3)C1)C2 |
| InChI | InChI=1S/C23H37FN4O2/c1-14-6-7-19(24)18-9-20(26-21(14)18)22(30)25-16-4-3-5-17(8-16)28-12-23(13-28)10-27(11-23)15(2)29/h14,16-21,26H,3-13H2,1-2H3,(H,25,30)/t14?,16-,17-,18?,19?,20?,21?/m1/s1 |
| InChIKey | SHPYFGRSUYKSRC-LMEDNSDBSA-N |
| XLogP | 1.69 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |