C23H36F4N4O3 — CID 167348496
4-fluoro-N-[(1R,3S)-3-[(3S)-4-(2-hydroxyacetyl)-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348496) has the molecular formula C23H36F4N4O3 and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,3S)-3-[(3S)-4-(2-hydroxyacetyl)-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-N-[(1R,3S)-3-[(3S)-4-(2-hydroxyacetyl)-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348496 |
| Molecular Formula | C23H36F4N4O3 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 4-fluoro-N-[(1R,3S)-3-[(3S)-4-(2-hydroxyacetyl)-3-(trifluoromethyl)piperazin-1-yl]cyclohexyl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)N[C@@H]3CCC[C@H](N4CCN(C(=O)CO)[C@H](C(F)(F)F)C4)C3)NC12 |
| InChI | InChI=1S/C23H36F4N4O3/c1-13-5-6-17(24)16-10-18(29-21(13)16)22(34)28-14-3-2-4-15(9-14)30-7-8-31(20(33)12-32)19(11-30)23(25,26)27/h13-19,21,29,32H,2-12H2,1H3,(H,28,34)/t13?,14-,15+,16?,17?,18?,19+,21?/m1/s1 |
| InChIKey | GFXZDORMFRSCBN-KLJFFMLCSA-N |
| XLogP | 1.60 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |