C23H41FN4O3S — CID 167348744
N-[(1R,3R)-3-[(3R)-3-[ethyl(methylsulfonyl)amino]pyrrolidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348744) has the molecular formula C23H41FN4O3S and a molecular weight of 472.67 g/mol. Its IUPAC name is N-[(1R,3R)-3-[(3R)-3-[ethyl(methylsulfonyl)amino]pyrrolidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3R)-3-[(3R)-3-[ethyl(methylsulfonyl)amino]pyrrolidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348744 |
| Molecular Formula | C23H41FN4O3S |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | N-[(1R,3R)-3-[(3R)-3-[ethyl(methylsulfonyl)amino]pyrrolidin-1-yl]cyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CCN([C@@H]1CCN([C@@H]2CCC[C@@H](NC(=O)C3CC4C(F)CCC(C)C4N3)C2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C23H41FN4O3S/c1-4-28(32(3,30)31)18-10-11-27(14-18)17-7-5-6-16(12-17)25-23(29)21-13-19-20(24)9-8-15(2)22(19)26-21/h15-22,26H,4-14H2,1-3H3,(H,25,29)/t15?,16-,17-,18-,19?,20?,21?,22?/m1/s1 |
| InChIKey | IHTPPTRTYUJTMA-WDLMUOTPSA-N |
| XLogP | 1.88 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |