C15H28N4O — CID 167380536
7-methyl-N-[(2-methylpyrazolidin-3-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380536) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 7-methyl-N-[(2-methylpyrazolidin-3-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | 7-methyl-N-[(2-methylpyrazolidin-3-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380536 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 7-methyl-N-[(2-methylpyrazolidin-3-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCCC2CC(C(=O)NCC3CCNN3C)NC12 |
| InChI | InChI=1S/C15H28N4O/c1-10-4-3-5-11-8-13(18-14(10)11)15(20)16-9-12-6-7-17-19(12)2/h10-14,17-18H,3-9H2,1-2H3,(H,16,20) |
| InChIKey | OEUDWOLNJTVVKL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |